C30H25F3N2O3 — CID 156882037
N-[4-(oxan-4-yl)-8-(2,3,5-trifluorophenyl)quinolin-3-yl]-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 156882037) has the molecular formula C30H25F3N2O3 and a molecular weight of 518.54 g/mol. Its IUPAC name is N-[4-(oxan-4-yl)-8-(2,3,5-trifluorophenyl)quinolin-3-yl]-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | N-[4-(oxan-4-yl)-8-(2,3,5-trifluorophenyl)quinolin-3-yl]-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 156882037 |
| Molecular Formula | C30H25F3N2O3 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[4-(oxan-4-yl)-8-(2,3,5-trifluorophenyl)quinolin-3-yl]-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | O=C(Nc1cnc2c(-c3cc(F)cc(F)c3F)cccc2c1C1CCOCC1)C1CCOc2ccccc21 |
| InChI | InChI=1S/C30H25F3N2O3/c31-18-14-23(28(33)24(32)15-18)20-5-3-6-22-27(17-8-11-37-12-9-17)25(16-34-29(20)22)35-30(36)21-10-13-38-26-7-2-1-4-19(21)26/h1-7,14-17,21H,8-13H2,(H,35,36) |
| InChIKey | CPJJBHJQLMQJJC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|