C60H50N2O12 — CID 138722736
pentabenzyl 6-[4-(dimethylamino)-3-ethoxycarbonylquinolin-8-yl]benzene-1,2,3,4,5-pentacarboxylate (PubChem CID 138722736) has the molecular formula C60H50N2O12 and a molecular weight of 991.06 g/mol. Its IUPAC name is pentabenzyl 6-[4-(dimethylamino)-3-ethoxycarbonylquinolin-8-yl]benzene-1,2,3,4,5-pentacarboxylate.
| Compound Name | pentabenzyl 6-[4-(dimethylamino)-3-ethoxycarbonylquinolin-8-yl]benzene-1,2,3,4,5-pentacarboxylate |
|---|---|
| PubChem CID | 138722736 |
| Molecular Formula | C60H50N2O12 |
| Molecular Weight | 991.06 g/mol |
| Exact Mass | 990.34 |
| IUPAC Name | pentabenzyl 6-[4-(dimethylamino)-3-ethoxycarbonylquinolin-8-yl]benzene-1,2,3,4,5-pentacarboxylate |
| SMILES | CCOC(=O)c1cnc2c(-c3c(C(=O)OCc4ccccc4)c(C(=O)OCc4ccccc4)c(C(=O)OCc4ccccc4)c(C(=O)OCc4ccccc4)c3C(=O)OCc3ccccc3)cccc2c1N(C)C |
| InChI | InChI=1S/C60H50N2O12/c1-4-69-55(63)46-33-61-53-44(31-20-32-45(53)54(46)62(2)3)47-48(56(64)70-34-39-21-10-5-11-22-39)50(58(66)72-36-41-25-14-7-15-26-41)52(60(68)74-38-43-29-18-9-19-30-43)51(59(67)73-37-42-27-16-8-17-28-42)49(47)57(65)71-35-40-23-12-6-13-24-40/h5-33H,4,34-38H2,1-3H3 |
| InChIKey | HFDRSGSIXXJPNH-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 173.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.06 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|