About 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate
3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate (PubChem CID 53269421) has the molecular formula C18H22N2O4
and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate.
Analyze 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate?
The IUPAC name of 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate (CID 53269421) is 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate?
The canonical SMILES for 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate is CCOC(=O)c1cnc2c(C(=O)OC)cccc2c1N(CC)CC.
What is the InChIKey of 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate?
The InChIKey is FEFCVDMGGYLRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O4/c1-5-20(6-2)16-12-9-8-10-13(17(21)23-4)15(12)19-11-14(16)18(22)24-7-3/h8-11H,5-7H2,1-4H3.
What are the key properties of 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate?
3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate has a molecular weight of 330.38 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 8-O-methyl 4-(diethylamino)quinoline-3,8-dicarboxylate is sourced from PubChem (CID 53269421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).