C26H29N3O4 — CID 23904512
3-O-ethyl 8-O-methyl 4-[4-(4-methylpiperidin-1-yl)anilino]quinoline-3,8-dicarboxylate (PubChem CID 23904512) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-O-ethyl 8-O-methyl 4-[4-(4-methylpiperidin-1-yl)anilino]quinoline-3,8-dicarboxylate.
| Compound Name | 3-O-ethyl 8-O-methyl 4-[4-(4-methylpiperidin-1-yl)anilino]quinoline-3,8-dicarboxylate |
|---|---|
| PubChem CID | 23904512 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-O-ethyl 8-O-methyl 4-[4-(4-methylpiperidin-1-yl)anilino]quinoline-3,8-dicarboxylate |
| SMILES | CCOC(=O)c1cnc2c(C(=O)OC)cccc2c1Nc1ccc(N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-4-33-26(31)22-16-27-23-20(6-5-7-21(23)25(30)32-3)24(22)28-18-8-10-19(11-9-18)29-14-12-17(2)13-15-29/h5-11,16-17H,4,12-15H2,1-3H3,(H,27,28) |
| InChIKey | YOVQLUDAAKGRFQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|