C22H19N3O4 — CID 17016669
ethyl 8-cyano-4-(4-ethoxycarbonylanilino)quinoline-3-carboxylate (PubChem CID 17016669) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is ethyl 8-cyano-4-(4-ethoxycarbonylanilino)quinoline-3-carboxylate.
| Compound Name | ethyl 8-cyano-4-(4-ethoxycarbonylanilino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 17016669 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl 8-cyano-4-(4-ethoxycarbonylanilino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Nc2c(C(=O)OCC)cnc3c(C#N)cccc23)cc1 |
| InChI | InChI=1S/C22H19N3O4/c1-3-28-21(26)14-8-10-16(11-9-14)25-20-17-7-5-6-15(12-23)19(17)24-13-18(20)22(27)29-4-2/h5-11,13H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | FVHLIXXSPOWWKL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |