C20H18N2O5 — CID 1191451
3-O-ethyl 8-O-methyl 4-(4-hydroxyanilino)quinoline-3,8-dicarboxylate (PubChem CID 1191451) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 3-O-ethyl 8-O-methyl 4-(4-hydroxyanilino)quinoline-3,8-dicarboxylate.
| Compound Name | 3-O-ethyl 8-O-methyl 4-(4-hydroxyanilino)quinoline-3,8-dicarboxylate |
|---|---|
| PubChem CID | 1191451 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-O-ethyl 8-O-methyl 4-(4-hydroxyanilino)quinoline-3,8-dicarboxylate |
| SMILES | CCOC(=O)c1cnc2c(C(=O)OC)cccc2c1Nc1ccc(O)cc1 |
| InChI | InChI=1S/C20H18N2O5/c1-3-27-20(25)16-11-21-17-14(5-4-6-15(17)19(24)26-2)18(16)22-12-7-9-13(23)10-8-12/h4-11,23H,3H2,1-2H3,(H,21,22) |
| InChIKey | DMQIHWYJRKKAIM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|