C20H22ClN3O2 — CID 13038524
ethyl 4-anilino-8-(dimethylamino)quinoline-3-carboxylate;hydrochloride (PubChem CID 13038524) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is ethyl 4-anilino-8-(dimethylamino)quinoline-3-carboxylate;hydrochloride.
| Compound Name | ethyl 4-anilino-8-(dimethylamino)quinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 13038524 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | ethyl 4-anilino-8-(dimethylamino)quinoline-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cnc2c(N(C)C)cccc2c1Nc1ccccc1.Cl |
| InChI | InChI=1S/C20H21N3O2.ClH/c1-4-25-20(24)16-13-21-19-15(11-8-12-17(19)23(2)3)18(16)22-14-9-6-5-7-10-14;/h5-13H,4H2,1-3H3,(H,21,22);1H |
| InChIKey | SSGZZDSQOCMZNK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |