C21H21IN2O5S — CID 54527784
ethyl 4-[ethyl-(4-methoxyphenyl)sulfonylamino]-8-iodoquinoline-3-carboxylate (PubChem CID 54527784) has the molecular formula C21H21IN2O5S and a molecular weight of 540.38 g/mol. Its IUPAC name is ethyl 4-[ethyl-(4-methoxyphenyl)sulfonylamino]-8-iodoquinoline-3-carboxylate.
| Compound Name | ethyl 4-[ethyl-(4-methoxyphenyl)sulfonylamino]-8-iodoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 54527784 |
| Molecular Formula | C21H21IN2O5S |
| Molecular Weight | 540.38 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | ethyl 4-[ethyl-(4-methoxyphenyl)sulfonylamino]-8-iodoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(I)cccc2c1N(CC)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21IN2O5S/c1-4-24(30(26,27)15-11-9-14(28-3)10-12-15)20-16-7-6-8-18(22)19(16)23-13-17(20)21(25)29-5-2/h6-13H,4-5H2,1-3H3 |
| InChIKey | YUIDHBWNATYHPQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|