C58H46N2O12 — CID 138722739
4-(dimethylamino)-8-[2,3,4,5,6-pentakis(phenylmethoxycarbonyl)phenyl]quinoline-3-carboxylic acid (PubChem CID 138722739) has the molecular formula C58H46N2O12 and a molecular weight of 963.01 g/mol. Its IUPAC name is 4-(dimethylamino)-8-[2,3,4,5,6-pentakis(phenylmethoxycarbonyl)phenyl]quinoline-3-carboxylic acid.
| Compound Name | 4-(dimethylamino)-8-[2,3,4,5,6-pentakis(phenylmethoxycarbonyl)phenyl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 138722739 |
| Molecular Formula | C58H46N2O12 |
| Molecular Weight | 963.01 g/mol |
| Exact Mass | 962.31 |
| IUPAC Name | 4-(dimethylamino)-8-[2,3,4,5,6-pentakis(phenylmethoxycarbonyl)phenyl]quinoline-3-carboxylic acid |
| SMILES | CN(C)c1c(C(=O)O)cnc2c(-c3c(C(=O)OCc4ccccc4)c(C(=O)OCc4ccccc4)c(C(=O)OCc4ccccc4)c(C(=O)OCc4ccccc4)c3C(=O)OCc3ccccc3)cccc12 |
| InChI | InChI=1S/C58H46N2O12/c1-60(2)52-43-30-18-29-42(51(43)59-31-44(52)53(61)62)45-46(54(63)68-32-37-19-8-3-9-20-37)48(56(65)70-34-39-23-12-5-13-24-39)50(58(67)72-36-41-27-16-7-17-28-41)49(57(66)71-35-40-25-14-6-15-26-40)47(45)55(64)69-33-38-21-10-4-11-22-38/h3-31H,32-36H2,1-2H3,(H,61,62) |
| InChIKey | CULKPDCZTHXSLV-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 184.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.01 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|