C38H31NO8 — CID 126657451
tetrabenzyl 6-methylpyridine-2,3,4,5-tetracarboxylate (PubChem CID 126657451) has the molecular formula C38H31NO8 and a molecular weight of 629.67 g/mol. Its IUPAC name is tetrabenzyl 6-methylpyridine-2,3,4,5-tetracarboxylate.
| Compound Name | tetrabenzyl 6-methylpyridine-2,3,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 126657451 |
| Molecular Formula | C38H31NO8 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | tetrabenzyl 6-methylpyridine-2,3,4,5-tetracarboxylate |
| SMILES | Cc1nc(C(=O)OCc2ccccc2)c(C(=O)OCc2ccccc2)c(C(=O)OCc2ccccc2)c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H31NO8/c1-26-31(35(40)44-22-27-14-6-2-7-15-27)32(36(41)45-23-28-16-8-3-9-17-28)33(37(42)46-24-29-18-10-4-11-19-29)34(39-26)38(43)47-25-30-20-12-5-13-21-30/h2-21H,22-25H2,1H3 |
| InChIKey | GDVDLIGGFFFHHT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|