C28H23N3O6 — CID 167060658
tribenzyl 2-aminopyrimidine-4,5,6-tricarboxylate (PubChem CID 167060658) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is tribenzyl 2-aminopyrimidine-4,5,6-tricarboxylate.
| Compound Name | tribenzyl 2-aminopyrimidine-4,5,6-tricarboxylate |
|---|---|
| PubChem CID | 167060658 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | tribenzyl 2-aminopyrimidine-4,5,6-tricarboxylate |
| SMILES | Nc1nc(C(=O)OCc2ccccc2)c(C(=O)OCc2ccccc2)c(C(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C28H23N3O6/c29-28-30-23(26(33)36-17-20-12-6-2-7-13-20)22(25(32)35-16-19-10-4-1-5-11-19)24(31-28)27(34)37-18-21-14-8-3-9-15-21/h1-15H,16-18H2,(H2,29,30,31) |
| InChIKey | DBTYJDQMOCWKBT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 130.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|