C38H28N8O8 — CID 134286326
dibenzyl 6-[[4,6-bis(phenylmethoxycarbonyl)-1,3,5-triazin-2-yl]diazenyl]-1,3,5-triazine-2,4-dicarboxylate (PubChem CID 134286326) has the molecular formula C38H28N8O8 and a molecular weight of 724.69 g/mol. Its IUPAC name is dibenzyl 6-[[4,6-bis(phenylmethoxycarbonyl)-1,3,5-triazin-2-yl]diazenyl]-1,3,5-triazine-2,4-dicarboxylate.
| Compound Name | dibenzyl 6-[[4,6-bis(phenylmethoxycarbonyl)-1,3,5-triazin-2-yl]diazenyl]-1,3,5-triazine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134286326 |
| Molecular Formula | C38H28N8O8 |
| Molecular Weight | 724.69 g/mol |
| Exact Mass | 724.20 |
| IUPAC Name | dibenzyl 6-[[4,6-bis(phenylmethoxycarbonyl)-1,3,5-triazin-2-yl]diazenyl]-1,3,5-triazine-2,4-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)c1nc(N=Nc2nc(C(=O)OCc3ccccc3)nc(C(=O)OCc3ccccc3)n2)nc(C(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C38H28N8O8/c47-33(51-21-25-13-5-1-6-14-25)29-39-30(34(48)52-22-26-15-7-2-8-16-26)42-37(41-29)45-46-38-43-31(35(49)53-23-27-17-9-3-10-18-27)40-32(44-38)36(50)54-24-28-19-11-4-12-20-28/h1-20H,21-24H2 |
| InChIKey | BJTGJPHCILTMGU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 207.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|