C12H11Br2N3O2 — CID 155058357
benzyl 5-(dibromomethyl)-1-methyl-1,2,4-triazole-3-carboxylate (PubChem CID 155058357) has the molecular formula C12H11Br2N3O2 and a molecular weight of 389.05 g/mol. Its IUPAC name is benzyl 5-(dibromomethyl)-1-methyl-1,2,4-triazole-3-carboxylate.
| Compound Name | benzyl 5-(dibromomethyl)-1-methyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 155058357 |
| Molecular Formula | C12H11Br2N3O2 |
| Molecular Weight | 389.05 g/mol |
| Exact Mass | 386.92 |
| IUPAC Name | benzyl 5-(dibromomethyl)-1-methyl-1,2,4-triazole-3-carboxylate |
| SMILES | Cn1nc(C(=O)OCc2ccccc2)nc1C(Br)Br |
| InChI | InChI=1S/C12H11Br2N3O2/c1-17-11(9(13)14)15-10(16-17)12(18)19-7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3 |
| InChIKey | DNUYBZJSLPBGHK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.05 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|