C12H12BrN3O2 — CID 138667259
benzyl 5-(bromomethyl)-1-methyl-1,2,4-triazole-3-carboxylate (PubChem CID 138667259) has the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. Its IUPAC name is benzyl 5-(bromomethyl)-1-methyl-1,2,4-triazole-3-carboxylate.
| Compound Name | benzyl 5-(bromomethyl)-1-methyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 138667259 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | benzyl 5-(bromomethyl)-1-methyl-1,2,4-triazole-3-carboxylate |
| SMILES | Cn1nc(C(=O)OCc2ccccc2)nc1CBr |
| InChI | InChI=1S/C12H12BrN3O2/c1-16-10(7-13)14-11(15-16)12(17)18-8-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | TZLANXOQJJHPGH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|