About copper(1+);2-phenylmethoxycarbonylbenzoate
copper(1+);2-phenylmethoxycarbonylbenzoate (PubChem CID 158888431) has the molecular formula C15H11CuO4
and a molecular weight of 318.80 g/mol. Its IUPAC name is copper(1+);2-phenylmethoxycarbonylbenzoate.
Molecular Properties
| Compound Name | copper(1+);2-phenylmethoxycarbonylbenzoate |
| PubChem CID | 158888431 |
| Molecular Formula | C15H11CuO4 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | copper(1+);2-phenylmethoxycarbonylbenzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)OCc1ccccc1.[Cu+] |
| InChI | InChI=1S/C15H12O4.Cu/c16-14(17)12-8-4-5-9-13(12)15(18)19-10-11-6-2-1-3-7-11;/h1-9H,10H2,(H,16,17);/q;+1/p-1 |
| InChIKey | JDXMJIXIWUPRBZ-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze copper(1+);2-phenylmethoxycarbonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);2-phenylmethoxycarbonylbenzoate?
The IUPAC name of copper(1+);2-phenylmethoxycarbonylbenzoate (CID 158888431) is copper(1+);2-phenylmethoxycarbonylbenzoate.
What is the SMILES notation for copper(1+);2-phenylmethoxycarbonylbenzoate?
The canonical SMILES for copper(1+);2-phenylmethoxycarbonylbenzoate is O=C([O-])c1ccccc1C(=O)OCc1ccccc1.[Cu+].
What is the InChIKey of copper(1+);2-phenylmethoxycarbonylbenzoate?
The InChIKey is JDXMJIXIWUPRBZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H12O4.Cu/c16-14(17)12-8-4-5-9-13(12)15(18)19-10-11-6-2-1-3-7-11;/h1-9H,10H2,(H,16,17);/q;+1/p-1.
What are the key properties of copper(1+);2-phenylmethoxycarbonylbenzoate?
copper(1+);2-phenylmethoxycarbonylbenzoate has a molecular weight of 318.80 g/mol, XLogP of 1.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);2-phenylmethoxycarbonylbenzoate is sourced from PubChem (CID 158888431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).