C12H10IN3O2 — CID 126639292
benzyl 3-iodo-6-methyl-1,2,4-triazine-5-carboxylate (PubChem CID 126639292) has the molecular formula C12H10IN3O2 and a molecular weight of 355.14 g/mol. Its IUPAC name is benzyl 3-iodo-6-methyl-1,2,4-triazine-5-carboxylate.
| Compound Name | benzyl 3-iodo-6-methyl-1,2,4-triazine-5-carboxylate |
|---|---|
| PubChem CID | 126639292 |
| Molecular Formula | C12H10IN3O2 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | benzyl 3-iodo-6-methyl-1,2,4-triazine-5-carboxylate |
| SMILES | Cc1nnc(I)nc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H10IN3O2/c1-8-10(14-12(13)16-15-8)11(17)18-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | METHIYBUUUKSTF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|