C14H10ClF2NO2 — CID 146489593
benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate (PubChem CID 146489593) has the molecular formula C14H10ClF2NO2 and a molecular weight of 297.69 g/mol. Its IUPAC name is benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate.
| Compound Name | benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 146489593 |
| Molecular Formula | C14H10ClF2NO2 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate |
| SMILES | Cc1c(F)c(F)nc(C(=O)OCc2ccccc2)c1Cl |
| InChI | InChI=1S/C14H10ClF2NO2/c1-8-10(15)12(18-13(17)11(8)16)14(19)20-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | MDDCOZYVOBBBPR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|