benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate

C14H10ClF2NO2 — CID 146489593

IUPACbenzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate
SMILESCc1c(F)c(F)nc(C(=O)OCc2ccccc2)c1Cl
InChIInChI=1S/C14H10ClF2NO2/c1-8-10(15)12(18-13(17)11(8)16)14(19)20-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3
InChIKeyMDDCOZYVOBBBPR-UHFFFAOYSA-N
MW297.69 g/mol
LogP3.68
Rot. Bonds3

About benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate

benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate (PubChem CID 146489593) has the molecular formula C14H10ClF2NO2 and a molecular weight of 297.69 g/mol. Its IUPAC name is benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate.

Molecular Properties

Compound Namebenzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate
PubChem CID146489593
Molecular FormulaC14H10ClF2NO2
Molecular Weight297.69 g/mol
Exact Mass297.04
IUPAC Namebenzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate
SMILESCc1c(F)c(F)nc(C(=O)OCc2ccccc2)c1Cl
InChIInChI=1S/C14H10ClF2NO2/c1-8-10(15)12(18-13(17)11(8)16)14(19)20-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3
InChIKeyMDDCOZYVOBBBPR-UHFFFAOYSA-N
XLogP3.68
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.69
LogP ≤ 53.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate?
The IUPAC name of benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate (CID 146489593) is benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate.
What is the SMILES notation for benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate?
The canonical SMILES for benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate is Cc1c(F)c(F)nc(C(=O)OCc2ccccc2)c1Cl.
What is the InChIKey of benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate?
The InChIKey is MDDCOZYVOBBBPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClF2NO2/c1-8-10(15)12(18-13(17)11(8)16)14(19)20-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3.
What are the key properties of benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate?
benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate has a molecular weight of 297.69 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate is sourced from PubChem (CID 146489593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).