C23H15Cl2FN2O2 — CID 146234930
benzyl 3,5-dichloro-2-(2-fluorophenyl)-7-methyl-1,6-naphthyridine-8-carboxylate (PubChem CID 146234930) has the molecular formula C23H15Cl2FN2O2 and a molecular weight of 441.29 g/mol. Its IUPAC name is benzyl 3,5-dichloro-2-(2-fluorophenyl)-7-methyl-1,6-naphthyridine-8-carboxylate.
| Compound Name | benzyl 3,5-dichloro-2-(2-fluorophenyl)-7-methyl-1,6-naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 146234930 |
| Molecular Formula | C23H15Cl2FN2O2 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | benzyl 3,5-dichloro-2-(2-fluorophenyl)-7-methyl-1,6-naphthyridine-8-carboxylate |
| SMILES | Cc1nc(Cl)c2cc(Cl)c(-c3ccccc3F)nc2c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H15Cl2FN2O2/c1-13-19(23(29)30-12-14-7-3-2-4-8-14)21-16(22(25)27-13)11-17(24)20(28-21)15-9-5-6-10-18(15)26/h2-11H,12H2,1H3 |
| InChIKey | NNTWXTVBKSOIFT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|