C20H14ClF2N2O3 — CID 140877200
CID 140877200 (PubChem CID 140877200) has the molecular formula C20H14ClF2N2O3 and a molecular weight of 403.79 g/mol.
| Compound Name | CID 140877200 |
|---|---|
| PubChem CID | 140877200 |
| Molecular Formula | C20H14ClF2N2O3 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | — |
| SMILES | COc1c(Cl)ccc(-c2nc(C(=O)OCc3ccccc3)cc([NH])c2F)c1F |
| InChI | InChI=1S/C20H14ClF2N2O3/c1-27-19-13(21)8-7-12(16(19)22)18-17(23)14(24)9-15(25-18)20(26)28-10-11-5-3-2-4-6-11/h2-9,24H,10H2,1H3 |
| InChIKey | HRRZRHPIJZPBTN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |