C24H20Cl3NO4 — CID 15950893
5-O-benzyl 3-O-ethyl 2-(chloromethyl)-4-(2,4-dichlorophenyl)-6-methylpyridine-3,5-dicarboxylate (PubChem CID 15950893) has the molecular formula C24H20Cl3NO4 and a molecular weight of 492.79 g/mol. Its IUPAC name is 5-O-benzyl 3-O-ethyl 2-(chloromethyl)-4-(2,4-dichlorophenyl)-6-methylpyridine-3,5-dicarboxylate.
| Compound Name | 5-O-benzyl 3-O-ethyl 2-(chloromethyl)-4-(2,4-dichlorophenyl)-6-methylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15950893 |
| Molecular Formula | C24H20Cl3NO4 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 5-O-benzyl 3-O-ethyl 2-(chloromethyl)-4-(2,4-dichlorophenyl)-6-methylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(CCl)nc(C)c(C(=O)OCc2ccccc2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H20Cl3NO4/c1-3-31-24(30)22-19(12-25)28-14(2)20(21(22)17-10-9-16(26)11-18(17)27)23(29)32-13-15-7-5-4-6-8-15/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | MLAXTRGOAHHIDA-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|