C21H22Cl2N2O3 — CID 11223924
ethyl (5E)-4-(2,4-dichlorophenyl)-5-hydroxyimino-2,7,7-trimethyl-6,8-dihydroquinoline-3-carboxylate (PubChem CID 11223924) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is ethyl (5E)-4-(2,4-dichlorophenyl)-5-hydroxyimino-2,7,7-trimethyl-6,8-dihydroquinoline-3-carboxylate.
| Compound Name | ethyl (5E)-4-(2,4-dichlorophenyl)-5-hydroxyimino-2,7,7-trimethyl-6,8-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11223924 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | ethyl (5E)-4-(2,4-dichlorophenyl)-5-hydroxyimino-2,7,7-trimethyl-6,8-dihydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc2c(c1-c1ccc(Cl)cc1Cl)/C(=N/O)CC(C)(C)C2 |
| InChI | InChI=1S/C21H22Cl2N2O3/c1-5-28-20(26)17-11(2)24-15-9-21(3,4)10-16(25-27)19(15)18(17)13-7-6-12(22)8-14(13)23/h6-8,27H,5,9-10H2,1-4H3/b25-16+ |
| InChIKey | BSOWMMNKFOCCKC-PCLIKHOPSA-N |
| XLogP | 5.69 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|