C23H26ClN3O2 — CID 78614567
N-[9-(4-chlorophenyl)-8-hydroxyimino-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridin-1-ylidene]hydroxylamine (PubChem CID 78614567) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is N-[9-(4-chlorophenyl)-8-hydroxyimino-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridin-1-ylidene]hydroxylamine.
| Compound Name | N-[9-(4-chlorophenyl)-8-hydroxyimino-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridin-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 78614567 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[9-(4-chlorophenyl)-8-hydroxyimino-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridin-1-ylidene]hydroxylamine |
| SMILES | CC1(C)CC(=NO)c2c(nc3c(c2-c2ccc(Cl)cc2)C(=NO)CC(C)(C)C3)C1 |
| InChI | InChI=1S/C23H26ClN3O2/c1-22(2)9-15-20(17(11-22)26-28)19(13-5-7-14(24)8-6-13)21-16(25-15)10-23(3,4)12-18(21)27-29/h5-8,28-29H,9-12H2,1-4H3 |
| InChIKey | FMWFLKPXEUHSBO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|