C16H18ClNO — CID 173392403
N-[3-[2-(4-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]hydroxylamine (PubChem CID 173392403) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is N-[3-[2-(4-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]hydroxylamine.
| Compound Name | N-[3-[2-(4-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 173392403 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[3-[2-(4-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]hydroxylamine |
| SMILES | CC1(C)CC(C=Cc2ccc(Cl)cc2)=CC(=NO)C1 |
| InChI | InChI=1S/C16H18ClNO/c1-16(2)10-13(9-15(11-16)18-19)4-3-12-5-7-14(17)8-6-12/h3-9,19H,10-11H2,1-2H3 |
| InChIKey | SIKOHIPJJGCIPQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|