C21H21N3O — CID 9032671
N-[4-[(E)-2-[3-(dicyanomethylidene)-5,5-dimethylcyclohexen-1-yl]ethenyl]phenyl]acetamide (PubChem CID 9032671) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[4-[(E)-2-[3-(dicyanomethylidene)-5,5-dimethylcyclohexen-1-yl]ethenyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-2-[3-(dicyanomethylidene)-5,5-dimethylcyclohexen-1-yl]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9032671 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[4-[(E)-2-[3-(dicyanomethylidene)-5,5-dimethylcyclohexen-1-yl]ethenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C2=CC(=C(C#N)C#N)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C21H21N3O/c1-15(25)24-20-8-6-16(7-9-20)4-5-17-10-18(19(13-22)14-23)12-21(2,3)11-17/h4-10H,11-12H2,1-3H3,(H,24,25)/b5-4+ |
| InChIKey | HZTXWYUWZSAMHK-SNAWJCMRSA-N |
| XLogP | 4.75 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|