About 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine
5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine (PubChem CID 13046106) has the molecular formula C13H13ClN2
and a molecular weight of 232.71 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine |
| PubChem CID | 13046106 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine |
| SMILES | Cc1nc(C)c(-c2ccc(Cl)cc2)c(C)n1 |
| InChI | InChI=1S/C13H13ClN2/c1-8-13(9(2)16-10(3)15-8)11-4-6-12(14)7-5-11/h4-7H,1-3H3 |
| InChIKey | CVWGDGRLWAHMBV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine?
The IUPAC name of 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine (CID 13046106) is 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine.
What is the SMILES notation for 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine?
The canonical SMILES for 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine is Cc1nc(C)c(-c2ccc(Cl)cc2)c(C)n1.
What is the InChIKey of 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine?
The InChIKey is CVWGDGRLWAHMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2/c1-8-13(9(2)16-10(3)15-8)11-4-6-12(14)7-5-11/h4-7H,1-3H3.
What are the key properties of 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine?
5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine has a molecular weight of 232.71 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,4,6-trimethylpyrimidine is sourced from PubChem (CID 13046106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).