C14H13ClO — CID 102112254
2-(4-chlorophenyl)-3,6-dimethylphenol (PubChem CID 102112254) has the molecular formula C14H13ClO and a molecular weight of 232.71 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,6-dimethylphenol.
| Compound Name | 2-(4-chlorophenyl)-3,6-dimethylphenol |
|---|---|
| PubChem CID | 102112254 |
| Molecular Formula | C14H13ClO |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-(4-chlorophenyl)-3,6-dimethylphenol |
| SMILES | Cc1ccc(C)c(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C14H13ClO/c1-9-3-4-10(2)14(16)13(9)11-5-7-12(15)8-6-11/h3-8,16H,1-2H3 |
| InChIKey | ZERDZDMTMZRIBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |