C14H12Cl2O — CID 82107036
2,4-dichloro-6-(3,4-dimethylphenyl)phenol (PubChem CID 82107036) has the molecular formula C14H12Cl2O and a molecular weight of 267.15 g/mol. Its IUPAC name is 2,4-dichloro-6-(3,4-dimethylphenyl)phenol.
| Compound Name | 2,4-dichloro-6-(3,4-dimethylphenyl)phenol |
|---|---|
| PubChem CID | 82107036 |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.15 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2,4-dichloro-6-(3,4-dimethylphenyl)phenol |
| SMILES | Cc1ccc(-c2cc(Cl)cc(Cl)c2O)cc1C |
| InChI | InChI=1S/C14H12Cl2O/c1-8-3-4-10(5-9(8)2)12-6-11(15)7-13(16)14(12)17/h3-7,17H,1-2H3 |
| InChIKey | WMARVCXAIXFLHL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.15 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |