C12H9Cl2NO — CID 39225052
2-(4-aminophenyl)-4,6-dichlorophenol (PubChem CID 39225052) has the molecular formula C12H9Cl2NO and a molecular weight of 254.12 g/mol. Its IUPAC name is 2-(4-aminophenyl)-4,6-dichlorophenol.
| Compound Name | 2-(4-aminophenyl)-4,6-dichlorophenol |
|---|---|
| PubChem CID | 39225052 |
| Molecular Formula | C12H9Cl2NO |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 2-(4-aminophenyl)-4,6-dichlorophenol |
| SMILES | Nc1ccc(-c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C12H9Cl2NO/c13-8-5-10(12(16)11(14)6-8)7-1-3-9(15)4-2-7/h1-6,16H,15H2 |
| InChIKey | ABVRKSGDLAIDOK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|