About 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride
4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride (PubChem CID 172846418) has the molecular formula C12H11Cl3N2
and a molecular weight of 289.59 g/mol. Its IUPAC name is 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride |
| PubChem CID | 172846418 |
| Molecular Formula | C12H11Cl3N2 |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(-c2c(Cl)cc(N)cc2Cl)cc1 |
| InChI | InChI=1S/C12H10Cl2N2.ClH/c13-10-5-9(16)6-11(14)12(10)7-1-3-8(15)4-2-7;/h1-6H,15-16H2;1H |
| InChIKey | XMFFQFIEQXGHKY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride?
The IUPAC name of 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride (CID 172846418) is 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride.
What is the SMILES notation for 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride?
The canonical SMILES for 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride is Cl.Nc1ccc(-c2c(Cl)cc(N)cc2Cl)cc1.
What is the InChIKey of 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride?
The InChIKey is XMFFQFIEQXGHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2.ClH/c13-10-5-9(16)6-11(14)12(10)7-1-3-8(15)4-2-7;/h1-6H,15-16H2;1H.
What are the key properties of 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride?
4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride has a molecular weight of 289.59 g/mol, XLogP of 4.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-3,5-dichloroaniline;hydrochloride is sourced from PubChem (CID 172846418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).