C16H18Cl4O2 — CID 145310067
2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)phenol;ethane (PubChem CID 145310067) has the molecular formula C16H18Cl4O2 and a molecular weight of 384.13 g/mol. Its IUPAC name is 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)phenol;ethane.
| Compound Name | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)phenol;ethane |
|---|---|
| PubChem CID | 145310067 |
| Molecular Formula | C16H18Cl4O2 |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)phenol;ethane |
| SMILES | CC.CC.Oc1c(Cl)cc(Cl)cc1-c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H6Cl4O2.2C2H6/c13-5-1-7(11(17)9(15)3-5)8-2-6(14)4-10(16)12(8)18;2*1-2/h1-4,17-18H;2*1-2H3 |
| InChIKey | PZBYCSAMJGKZAM-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |