C8H8Cl2N2O — CID 135541682
2,4-dichloro-6-ethanehydrazonoylphenol (PubChem CID 135541682) has the molecular formula C8H8Cl2N2O and a molecular weight of 219.07 g/mol. Its IUPAC name is 2,4-dichloro-6-ethanehydrazonoylphenol.
| Compound Name | 2,4-dichloro-6-ethanehydrazonoylphenol |
|---|---|
| PubChem CID | 135541682 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2,4-dichloro-6-ethanehydrazonoylphenol |
| SMILES | C/C(=N\N)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C8H8Cl2N2O/c1-4(12-11)6-2-5(9)3-7(10)8(6)13/h2-3,13H,11H2,1H3/b12-4+ |
| InChIKey | CASVZNKXIBRZOU-UUILKARUSA-N |
| XLogP | 2.38 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|