C9H9Cl2N3OS — CID 2803900
[1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]thiourea (PubChem CID 2803900) has the molecular formula C9H9Cl2N3OS and a molecular weight of 278.16 g/mol. Its IUPAC name is [1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]thiourea.
| Compound Name | [1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 2803900 |
| Molecular Formula | C9H9Cl2N3OS |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | [1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]thiourea |
| SMILES | CC(=NNC(N)=S)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C9H9Cl2N3OS/c1-4(13-14-9(12)16)6-2-5(10)3-7(11)8(6)15/h2-3,15H,1H3,(H3,12,14,16) |
| InChIKey | UYHNGSBAXPMDJP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|