About 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one
3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 101110060) has the molecular formula C7H3Cl3O2
and a molecular weight of 225.46 g/mol. Its IUPAC name is 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one.
Analyze 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one?
The IUPAC name of 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one (CID 101110060) is 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one is O=c1c(Cl)cc(Cl)cc(Cl)c1O.
What is the InChIKey of 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one?
The InChIKey is VXUWZYVVMWWROL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl3O2/c8-3-1-4(9)6(11)7(12)5(10)2-3/h1-2H,(H,11,12).
What are the key properties of 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one?
3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one has a molecular weight of 225.46 g/mol, XLogP of 2.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trichloro-2-hydroxycyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 101110060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).