C6H4Cl2NaO4S — CID 87271498
3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt (PubChem CID 87271498) has the molecular formula C6H4Cl2NaO4S and a molecular weight of 266.06 g/mol.
| Compound Name | 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt |
|---|---|
| PubChem CID | 87271498 |
| Molecular Formula | C6H4Cl2NaO4S |
| Molecular Weight | 266.06 g/mol |
| Exact Mass | 264.91 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(Cl)cc(Cl)c1O.[Na] |
| InChI | InChI=1S/C6H4Cl2O4S.Na/c7-3-1-4(8)6(9)5(2-3)13(10,11)12;/h1-2,9H,(H,10,11,12); |
| InChIKey | VCILYNOSKHDKEM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.06 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|