C12H6BaCl4O8S2 — CID 139842253
barium(2+);bis(3,5-dichloro-2-hydroxybenzenesulfonate) (PubChem CID 139842253) has the molecular formula C12H6BaCl4O8S2 and a molecular weight of 621.45 g/mol. Its IUPAC name is barium(2+);bis(3,5-dichloro-2-hydroxybenzenesulfonate).
| Compound Name | barium(2+);bis(3,5-dichloro-2-hydroxybenzenesulfonate) |
|---|---|
| PubChem CID | 139842253 |
| Molecular Formula | C12H6BaCl4O8S2 |
| Molecular Weight | 621.45 g/mol |
| Exact Mass | 619.73 |
| IUPAC Name | barium(2+);bis(3,5-dichloro-2-hydroxybenzenesulfonate) |
| SMILES | O=S(=O)([O-])c1cc(Cl)cc(Cl)c1O.O=S(=O)([O-])c1cc(Cl)cc(Cl)c1O.[Ba+2] |
| InChI | InChI=1S/2C6H4Cl2O4S.Ba/c2*7-3-1-4(8)6(9)5(2-3)13(10,11)12;/h2*1-2,9H,(H,10,11,12);/q;;+2/p-2 |
| InChIKey | LKEMVYSXYXYMSX-UHFFFAOYSA-L |
| XLogP | 2.83 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|