C14H11Cl3O3S — CID 159246724
2,4-dichloro-6-[(3-chloro-5-methylphenyl)methylsulfonyl]phenol (PubChem CID 159246724) has the molecular formula C14H11Cl3O3S and a molecular weight of 365.67 g/mol. Its IUPAC name is 2,4-dichloro-6-[(3-chloro-5-methylphenyl)methylsulfonyl]phenol.
| Compound Name | 2,4-dichloro-6-[(3-chloro-5-methylphenyl)methylsulfonyl]phenol |
|---|---|
| PubChem CID | 159246724 |
| Molecular Formula | C14H11Cl3O3S |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2,4-dichloro-6-[(3-chloro-5-methylphenyl)methylsulfonyl]phenol |
| SMILES | Cc1cc(Cl)cc(CS(=O)(=O)c2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C14H11Cl3O3S/c1-8-2-9(4-10(15)3-8)7-21(19,20)13-6-11(16)5-12(17)14(13)18/h2-6,18H,7H2,1H3 |
| InChIKey | RIISESVYIFSSAV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |