C14H11Cl2FO3S — CID 159479800
2,4-dichloro-6-[(2-fluoro-5-methylphenyl)methylsulfonyl]phenol (PubChem CID 159479800) has the molecular formula C14H11Cl2FO3S and a molecular weight of 349.21 g/mol. Its IUPAC name is 2,4-dichloro-6-[(2-fluoro-5-methylphenyl)methylsulfonyl]phenol.
| Compound Name | 2,4-dichloro-6-[(2-fluoro-5-methylphenyl)methylsulfonyl]phenol |
|---|---|
| PubChem CID | 159479800 |
| Molecular Formula | C14H11Cl2FO3S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2,4-dichloro-6-[(2-fluoro-5-methylphenyl)methylsulfonyl]phenol |
| SMILES | Cc1ccc(F)c(CS(=O)(=O)c2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C14H11Cl2FO3S/c1-8-2-3-12(17)9(4-8)7-21(19,20)13-6-10(15)5-11(16)14(13)18/h2-6,18H,7H2,1H3 |
| InChIKey | LWVXAPDPBXESOM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |