C19H14ClFO3S — CID 160808013
2-chloro-6-[(2-fluoro-5-phenylphenyl)methylsulfonyl]phenol (PubChem CID 160808013) has the molecular formula C19H14ClFO3S and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-chloro-6-[(2-fluoro-5-phenylphenyl)methylsulfonyl]phenol.
| Compound Name | 2-chloro-6-[(2-fluoro-5-phenylphenyl)methylsulfonyl]phenol |
|---|---|
| PubChem CID | 160808013 |
| Molecular Formula | C19H14ClFO3S |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-chloro-6-[(2-fluoro-5-phenylphenyl)methylsulfonyl]phenol |
| SMILES | O=S(=O)(Cc1cc(-c2ccccc2)ccc1F)c1cccc(Cl)c1O |
| InChI | InChI=1S/C19H14ClFO3S/c20-16-7-4-8-18(19(16)22)25(23,24)12-15-11-14(9-10-17(15)21)13-5-2-1-3-6-13/h1-11,22H,12H2 |
| InChIKey | SDYICSQZHLGMJY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |