C21H16Cl2O3S — CID 159695182
1-[2-[(3,5-dichlorophenyl)sulfonylmethyl]-4-phenylphenyl]ethenol (PubChem CID 159695182) has the molecular formula C21H16Cl2O3S and a molecular weight of 419.33 g/mol. Its IUPAC name is 1-[2-[(3,5-dichlorophenyl)sulfonylmethyl]-4-phenylphenyl]ethenol.
| Compound Name | 1-[2-[(3,5-dichlorophenyl)sulfonylmethyl]-4-phenylphenyl]ethenol |
|---|---|
| PubChem CID | 159695182 |
| Molecular Formula | C21H16Cl2O3S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 1-[2-[(3,5-dichlorophenyl)sulfonylmethyl]-4-phenylphenyl]ethenol |
| SMILES | C=C(O)c1ccc(-c2ccccc2)cc1CS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2O3S/c1-14(24)21-8-7-16(15-5-3-2-4-6-15)9-17(21)13-27(25,26)20-11-18(22)10-19(23)12-20/h2-12,24H,1,13H2 |
| InChIKey | SETRUHYSZGNBPF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|