C20H13ClF2O4S — CID 157440067
3-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]benzoic acid (PubChem CID 157440067) has the molecular formula C20H13ClF2O4S and a molecular weight of 422.84 g/mol. Its IUPAC name is 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]benzoic acid.
| Compound Name | 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 157440067 |
| Molecular Formula | C20H13ClF2O4S |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)methylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)Cc2cc(-c3ccccc3)c(F)cc2F)c1 |
| InChI | InChI=1S/C20H13ClF2O4S/c21-15-6-13(20(24)25)7-16(9-15)28(26,27)11-14-8-17(19(23)10-18(14)22)12-4-2-1-3-5-12/h1-10H,11H2,(H,24,25) |
| InChIKey | BROIPHHVWBBOOM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |