C19H12Cl2FNO4S — CID 146545847
2-[(3,5-dichlorophenyl)sulfonylamino]-5-fluoro-4-phenylbenzoic acid (PubChem CID 146545847) has the molecular formula C19H12Cl2FNO4S and a molecular weight of 440.28 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)sulfonylamino]-5-fluoro-4-phenylbenzoic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)sulfonylamino]-5-fluoro-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 146545847 |
| Molecular Formula | C19H12Cl2FNO4S |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)sulfonylamino]-5-fluoro-4-phenylbenzoic acid |
| SMILES | O=C(O)c1cc(F)c(-c2ccccc2)cc1NS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2FNO4S/c20-12-6-13(21)8-14(7-12)28(26,27)23-18-10-15(11-4-2-1-3-5-11)17(22)9-16(18)19(24)25/h1-10,23H,(H,24,25) |
| InChIKey | FGSWYONWAUFHHL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |