C20H15ClF2N2O4S — CID 146545980
3-chloro-5-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]-4-hydroxy-N-methylbenzamide (PubChem CID 146545980) has the molecular formula C20H15ClF2N2O4S and a molecular weight of 452.87 g/mol. Its IUPAC name is 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]-4-hydroxy-N-methylbenzamide.
| Compound Name | 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]-4-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 146545980 |
| Molecular Formula | C20H15ClF2N2O4S |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 3-chloro-5-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]-4-hydroxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(Cl)c(O)c(S(=O)(=O)Nc2cc(-c3ccccc3)c(F)cc2F)c1 |
| InChI | InChI=1S/C20H15ClF2N2O4S/c1-24-20(27)12-7-14(21)19(26)18(8-12)30(28,29)25-17-9-13(15(22)10-16(17)23)11-5-3-2-4-6-11/h2-10,25-26H,1H3,(H,24,27) |
| InChIKey | MPFWZFYFHBFUGM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |