C19H12Cl2FNO5S — CID 146545806
2-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-5-fluoro-4-phenylbenzoic acid (PubChem CID 146545806) has the molecular formula C19H12Cl2FNO5S and a molecular weight of 456.28 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-5-fluoro-4-phenylbenzoic acid.
| Compound Name | 2-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-5-fluoro-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 146545806 |
| Molecular Formula | C19H12Cl2FNO5S |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | 2-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-5-fluoro-4-phenylbenzoic acid |
| SMILES | O=C(O)c1cc(F)c(-c2ccccc2)cc1NS(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H12Cl2FNO5S/c20-11-6-14(21)18(24)17(7-11)29(27,28)23-16-9-12(10-4-2-1-3-5-10)15(22)8-13(16)19(25)26/h1-9,23-24H,(H,25,26) |
| InChIKey | GIDRNFOZAUXJPE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|