C20H17NO5S — CID 166324508
2-hydroxy-5-methyl-3-[(2-phenylphenyl)sulfamoyl]benzoic acid (PubChem CID 166324508) has the molecular formula C20H17NO5S and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-3-[(2-phenylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 2-hydroxy-5-methyl-3-[(2-phenylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 166324508 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-hydroxy-5-methyl-3-[(2-phenylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)c(O)c(S(=O)(=O)Nc2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C20H17NO5S/c1-13-11-16(20(23)24)19(22)18(12-13)27(25,26)21-17-10-6-5-9-15(17)14-7-3-2-4-8-14/h2-12,21-22H,1H3,(H,23,24) |
| InChIKey | XLCHLIHUOSGBAX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |