C20H18BrNO2S — CID 166373629
4-bromo-2,5-dimethyl-N-(2-phenylphenyl)benzenesulfonamide (PubChem CID 166373629) has the molecular formula C20H18BrNO2S and a molecular weight of 416.34 g/mol. Its IUPAC name is 4-bromo-2,5-dimethyl-N-(2-phenylphenyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,5-dimethyl-N-(2-phenylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166373629 |
| Molecular Formula | C20H18BrNO2S |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 4-bromo-2,5-dimethyl-N-(2-phenylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccccc2-c2ccccc2)c(C)cc1Br |
| InChI | InChI=1S/C20H18BrNO2S/c1-14-13-20(15(2)12-18(14)21)25(23,24)22-19-11-7-6-10-17(19)16-8-4-3-5-9-16/h3-13,22H,1-2H3 |
| InChIKey | PNMVZPZGFLNPBH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |