C17H20BrNO2S — CID 146147461
2-bromo-4,5-dimethyl-N-(2-propan-2-ylphenyl)benzenesulfonamide (PubChem CID 146147461) has the molecular formula C17H20BrNO2S and a molecular weight of 382.32 g/mol. Its IUPAC name is 2-bromo-4,5-dimethyl-N-(2-propan-2-ylphenyl)benzenesulfonamide.
| Compound Name | 2-bromo-4,5-dimethyl-N-(2-propan-2-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 146147461 |
| Molecular Formula | C17H20BrNO2S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-bromo-4,5-dimethyl-N-(2-propan-2-ylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)Nc2ccccc2C(C)C)cc1C |
| InChI | InChI=1S/C17H20BrNO2S/c1-11(2)14-7-5-6-8-16(14)19-22(20,21)17-10-13(4)12(3)9-15(17)18/h5-11,19H,1-4H3 |
| InChIKey | CZRGDMCKOKUUEC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |