C15H14ClNO5S — CID 51126123
3-[(2-chloro-4-methylphenyl)sulfamoyl]-2-hydroxy-5-methylbenzoic acid (PubChem CID 51126123) has the molecular formula C15H14ClNO5S and a molecular weight of 355.80 g/mol. Its IUPAC name is 3-[(2-chloro-4-methylphenyl)sulfamoyl]-2-hydroxy-5-methylbenzoic acid.
| Compound Name | 3-[(2-chloro-4-methylphenyl)sulfamoyl]-2-hydroxy-5-methylbenzoic acid |
|---|---|
| PubChem CID | 51126123 |
| Molecular Formula | C15H14ClNO5S |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 3-[(2-chloro-4-methylphenyl)sulfamoyl]-2-hydroxy-5-methylbenzoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C)cc(C(=O)O)c2O)c(Cl)c1 |
| InChI | InChI=1S/C15H14ClNO5S/c1-8-3-4-12(11(16)6-8)17-23(21,22)13-7-9(2)5-10(14(13)18)15(19)20/h3-7,17-18H,1-2H3,(H,19,20) |
| InChIKey | QTDQKXRURPBZKQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |