C15H13Cl2NO4S — CID 78843133
3,4-dichloro-5-[(2,4-dimethylphenyl)sulfamoyl]benzoic acid (PubChem CID 78843133) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is 3,4-dichloro-5-[(2,4-dimethylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 3,4-dichloro-5-[(2,4-dimethylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 78843133 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 3,4-dichloro-5-[(2,4-dimethylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C(=O)O)cc(Cl)c2Cl)c(C)c1 |
| InChI | InChI=1S/C15H13Cl2NO4S/c1-8-3-4-12(9(2)5-8)18-23(21,22)13-7-10(15(19)20)6-11(16)14(13)17/h3-7,18H,1-2H3,(H,19,20) |
| InChIKey | NDHMVFMWPGYUQD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |