C21H24ClN3O4S — CID 5236440
1-[4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]benzoyl]piperidine-4-carboxamide (PubChem CID 5236440) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 1-[4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]benzoyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5236440 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[4-chloro-3-[(2,4-dimethylphenyl)sulfamoyl]benzoyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C(=O)N3CCC(C(N)=O)CC3)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C21H24ClN3O4S/c1-13-3-6-18(14(2)11-13)24-30(28,29)19-12-16(4-5-17(19)22)21(27)25-9-7-15(8-10-25)20(23)26/h3-6,11-12,15,24H,7-10H2,1-2H3,(H2,23,26) |
| InChIKey | MCYSIZLJSCGNJQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |