C20H20Cl2N2O5S — CID 55350196
methyl 1-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]benzoyl]piperidine-4-carboxylate (PubChem CID 55350196) has the molecular formula C20H20Cl2N2O5S and a molecular weight of 471.36 g/mol. Its IUPAC name is methyl 1-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]benzoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55350196 |
| Molecular Formula | C20H20Cl2N2O5S |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | methyl 1-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]benzoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C20H20Cl2N2O5S/c1-29-20(26)13-8-10-24(11-9-13)19(25)14-2-7-17(22)18(12-14)30(27,28)23-16-5-3-15(21)4-6-16/h2-7,12-13,23H,8-11H2,1H3 |
| InChIKey | AZPRVTJPTLWGLN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |